Search

Interaction of glyphosate (N-(phosphonomethyl)-glycine) with six polyamines (ethylendiamine, cadaverine, putrescine, triethylenetetramine, spermine, and tetraethylenepentamine) was studied potentiometrically. Several species of different stoichiometry are formed in the various systems, according to the general formation reaction AH i+ i + Hj (glp)(j3) = A(glp)H(i+j3) i+j (where A = amine and glp = glyphosate). The complex species formed are always A(glp)Hr(r3) with r = 1 ... (n + 2) (n = maximum degree of protonation of amines). The stability of various complexes is a linear function of chargesinvolved in the formation reaction, and can be expressed as logKij = 0.9(10.2)zeta (where zeta= i[3 j]). From the temperature dependence of formation constants, deltaH0 (and TdeltaS0) values have been obtained. Formation percentages of mixed glyphosate-polyammonium cation complexes are relevant also in low concentration conditions, and this means that these species may play a significant role in the speciation of natural fluids containing the reactants. [ABSTRACT FROM AUTHOR]

In the title compound, C(6)H(18)N(2)(2+).C(4)H(4)O(4)(2-).C(4)H(6)O(4), the components lie on centres of symmetry in space group P-1, such that the asymmetric unit contains three half-molecules. Despite the different mode (with respect to other dicarboxylic acids) adopted by the intermolecular self-interaction of succinic acid derivatives, the overall structure of the title compound consists of anionic layers that are typical of the packing structures exhibited by other dicarboxylic acid analogues.